Chemistry Learner

It's all about Chemistry

Home / Organic Chemistry / Constitutional Isomers

Constitutional Isomers

Constitutional isomers, also called structural isomers, are compounds that have the same molecular formula but differ in the connectivity of the atoms. Connectivity means which atoms are bonded to which within the molecule. [1–4]

Constitutional isomers have distinct physical and chemical properties, such as molecular shape, boiling point, polarity, and reactivity. For example, butane and 2-methylpropane (isobutane) both are C4H10, but have boiling points of approximately –0.5 °C and –11.7 °C, respectively.

Types

Constitutional Isomers

1. Chain or Skeletal Isomers

Chain isomers differ in the arrangement of the carbon skeleton. One may have a straight chain, while another has a branched chain. [1,2,6,7]

There is no universal formula for calculating the number of constitutional isomers for every molecular formula, but small alkanes follow a well-known pattern:

  • C4H10 – 2 isomers
  • C5H12 – 3 isomers
  • C6H14 – 5 isomers
  • C7H16 – 9 isomers

Examples

Molecular FormulaCondensed Structural FormulaIUPAC Name (another name)Straight or Branched
C4H10CH3CH2CH2CH3ButaneStraight
CH3CH(CH3)CH32–Methylpropane (isobutane)Branched
C5H12CH3CH2CH2CH2CH3PentaneStraight
CH3CH(CH3)CH2CH32–Methylbutane (isopentane)Branched
C(CH3)42,2–Dimethylpropane (neopentane)Branched
C6H14CH3CH2CH2CH2CH2CH3HexaneStraight
CH3CH(CH3)CH2CH2CH32–MethylpentaneBranched
CH3CH2CH(CH3)CH2CH33–MethylpentaneBranched
CH3C(CH3)2CH2CH32,2–DimethylbutaneBranched
CH3CH(CH3)CH(CH3)CH32,3–DimethylbutaneBranched

Methane, ethane, and propane cannot form constitutional isomers because alkanes need at least four carbons for chain isomerism. These molecules have only one carbon skeleton each.

As far as the physical properties are concerned, branched alkane structures generally have lower boiling points than their straight-chain counterparts. It is because branching reduces the surface area available for intermolecular attractions, especially London dispersion forces.

Isomers of Butane
Isomers of Pentane

2. Positional Isomers

Positional isomers have the same carbon skeleton, but the position of the functional group, substituent, or multiple bond changes within the molecule.

Examples

Molecular FormulaCondensed Structural FormulaIUPAC Name (another name)
C4H8CH3CH2CH=CH2But-1-ene
CH3CH=CHCH3But-2-ene
C5H10OCH3CH2CH2COCH3Pentan-2-one (methyl propyl ketone)
CH3CH2COCH2CH3Pentan-3-one (diethyl ketone)
C4H10OCH3CH2CH2CH2OHButan-1-ol
CH3CH2CH(OH)CH3Butan-2-ol
CH3CH(CH3)CH2OH2-Methylpropan-1-ol (isobutanol)
(CH3)3COH2-Methylpropan-2-ol (tert-butanol)
Isomers of Butanol

3. Functional Group Isomers

Functional group isomers have the same molecular formula but different functional groups.

Examples

Molecular FormulaCondensed Structural FormulaIUPAC Name (another name)Functional Group
C2H6OC2H5OHEthanolAlcohol
CH3OCH3Methoxymethane (dimethyl ether)Ether
C3H6OCH3CH2CHOPropanalAldehyde
CH3COCH3Propanone (acetone)Ketone
C3H6O2CH3CH2COOHPropanoic acidCarboxylic acid
CH3COOCH3Methyl ethanoateEster
Functional Isomers

How to Draw Constitutional Isomers

To draw constitutional isomers systematically, follow this process: [5]

  1. Write the molecular formula.
  2. Choose the longest possible carbon chain.
  3. Draw one valid structure.
  4. Change the branching or the position of the functional group.
  5. Check that all atoms satisfy their correct valency.
  6. Remove any redrawn duplicates.
  7. Stop when no new connectivity is possible.
How to Draw Constitutional Isomers

Constitutional isomers demonstrate that a molecular formula alone is insufficient to predict how a compound will behave. This idea is a foundation of organic chemistry and helps explain why substances with the same atoms can have different properties, uses, and reactions in both laboratory and real-world applications.

Multiple Choice Questions

Question 1

Which of the following is a constitutional isomer of heptane?
A. CH3CH(CH3)CH2CH2CH2CH3
B. CH3CH2CH2CH2CH2CH3
C. CH3CH2CH2CH=CHCH2CH3
D. CH3CH2CH2CH2CH2CH2CH2OH

Answer

Heptane has the molecular formula C7H16. Its condensed structural formula is CH3CH2CH2CH2CH2CH2CH3.

Constitutional isomers must have:

  • the same molecular formula
  • different connectivity

Now check each option:

A. CH3CH(CH3)CH2CH2CH2CH3 is 2–methylhexane. It has the same molecular formula as heptane, but a different connectivity. Therefore, it is a constitutional isomer of heptane.
B. CH3CH2CH2CH2CH2CH3 is hexane. Its molecular formula is C6H14, not C7H16. Therefore, it is not a constitutional isomer of heptane.
C. CH3CH2CH2CH=CHCH2CH3 is hept–3–ene. Its molecular formula is C7H14, not C7H16. Therefore, it is not a constitutional isomer of heptane.
D. CH3CH2CH2CH2CH2CH2CH2OH is heptan–1–ol. Its molecular formula is C7H16O, not C7H16. Therefore, it is not a constitutional isomer of heptane.

The correct answer is A.

Question 2

The following are the condensed structural formulas of two different compounds.
i: CH3CH2CH2OH
ii: CH3CH(OH)CH3

Are they constitutional isomers? Choose the correct answer.

A. Yes, they have the same molecular formula and connectivity.

B. Yes, they have the same molecular formula, but their atomic connectivities are different.

C. No, they do not have the same molecular formula and connectivity.

D. No, they have different molecular formulas but have the same connectivity.

Answer

To decide whether these are constitutional isomers, follow the steps below.
Step 1: Check the molecular formula
CH3CH2CH2OH has the formula C3H8O
CH3CH(OH)CH3 also has the formula C3H8O

Both compounds have the same molecular formula.

Step 2: Check whether each atom is connected to the same neighbors
In CH3CH2CH2OH, the OH group is attached to the first carbon.
In CH3CH(OH)CH3 , the OH group is attached to the second carbon.

The atoms are not connected in the same way. Their connectivity differs.

Since the two compounds have the same molecular formula but different connectivity, they are constitutional isomers.

The correct answer is B.

Leave a Reply

Your email address will not be published. Required fields are marked *