Chemistry Learner

It's all about Chemistry

Home / Physical Chemistry / Naming Ionic Compounds

Naming Ionic Compounds

An ionic compound is a chemical substance made up of positively and negatively charged ions. These ions are held together by strong electrostatic forces, and the chemical bond formed in these compounds is called an ionic bond. Naming ionic compounds is an essential skill in chemistry because it helps us clearly and systematically describe what a substance is made of. [1-4]

Why Is Naming Important [3,4]

Learning to name compounds is important because it shows what elements are present, helps predict properties, ensures safety, and follows IUPAC rules so chemists everywhere understand each other. It also builds a strong foundation for more advanced chemistry topics.

There are two main types of ionic compounds: binary ionic compounds and polyatomic ionic compounds

1. Binary Ionic Compounds

They are the simplest of all ionic compounds. A binary ionic compound consists of a metal and a nonmetal. The metal loses electrons and forms a positively charged cation, and the nonmetal gains electrons and forms a negatively charged anion. The ions are monatomic. [1-6]

Naming Rules

  1. Name the metal first. Use the name as it appears on the periodic table
  2. Name the anion next. Use the root of the element’s name and add the suffix “-ide”.
  3. Write the cation name first, followed by the anion.

Note: No prefixes (mono-, di-, etc.) are used.

A. Cations with Invariable Charge

Some cations can form only one charge (e.g., Na+, Ca2+).

Example: NaCl

  1. Sodium (Na) loses one electron and becomes the cation, Na+.
  2. Chlorine (Cl) gains one electron and becomes the anion, Cl. Add “ide” to the root of “chlorine” to make it “chloride”.
  3. Na+ and Cl combine to form NaCl, and we call it sodium chloride.

The table below gives a few more examples.

FormulaCation (Metal)Anion (Nonmetal’s “ide” form)Name
MgOMagnesiumOxideMagnesium oxide
CaSCalciumSulfideCalcium sulfide
Li₂OLithiumOxideLithium oxide
Al₂S₃AluminumSulfideAluminum sulfide
KBrPotassiumBromidePotassium bromide
Naming Ionic Compounds

B. Cations with Variable Charges

Some metals can form more than one ion with different charges. These are usually transition metals (e.g., Fe2+, Fe3+). The naming convention is the same as before, but we must use Roman numerals to specify the charge. We place them within parentheses after the metal’s name. Such a naming system is called the Stock System. It is a method developed by German chemist Alfred Stock to clearly indicate the oxidation state (or charge) of a metal in a compound.

Example: FeCl3.

Here is a step-by-step explanation of how to name an ionic compound using the Stock System.

Step 1: Write Down the Formula

Start with the chemical formula of the compound. 

The chemical formula of the compound under consideration is FeCl3.

Step 2: Identify the Charge on the Nonmetal (Anion)

Use known oxidation states from periodic table rules. 

In FeCl3, each Cl has an oxidation number of –1.

Step 3: Multiply the Anion’s Charge by Its Subscript

This gives the total negative charge.

In FeCl3, there are 3 Cl⁻ ions, each with –1. Therefore, total negative charge = 3 × (–1) = –3

Step 4: Set the Total Charge Equal to Zero (or the Ion’s Charge)

The total oxidation numbers must equal zero (for neutral compounds) or the ion’s charge (if it is a polyatomic ion).

FeCl3 is neutral, so Fe + (–3) = 0 => Fe = +3

Step 5: Write the Stock Name

Now write the name of the compound with the metal followed by its oxidation number in Roman numerals in parentheses. Then, add the nonmetal name, as before.

Therefore, FeCl3 is iron(III) chloride.

Here are some more examples.

FormulaCation (Metal)ChargeAnion (Nonmetal’s root name + “ide”)Name
FeCl3Iron+3ChlorideIron(III) chloride
CuClCopper+1ChlorideCopper(I) chloride
CuCl₂Copper+2ChlorideCopper(II) chloride
PbOLead+2OxideLead(II) oxide
PbO₂Lead+4OxideLead(IV) oxide

Note: An older naming system used “-ic” and “-ous” suffixes (e.g., ferric for Fe³⁺, ferrous for Fe²⁺). This system is outdated and mostly replaced by the Stock System, but still seen in industry.

2. Polyatomic Ionic Compounds

A polyatomic ion is a group of atoms bonded together that acts as a single charged ion. Their naming style is similar to monatomic ions, except the ending could be one of the following: “-ide”, “-ate”, and “-ite”. [3,4,7]

Naming Rules

  1. Name the cation first. If it is a metal, use the element’s name. If it is a polyatomic cation, use its ion name (e.g., ammonium).
  2. Name the anion next. If it is a single atom, use “-ide”. If it is a polyatomic anion, use its standard name (e.g., sulfate, nitrite).

Some polyatomic anions include oxygen and are known as oxyanions. If an element forms two different oxyanions, the one with fewer oxygen atoms is named with the suffix “-ite”, while the one with more oxygen atoms ends in “-ate”.

When there are four oxyanions in a series, the prefixes “hypo-” and “per-” are combined with the suffixes “-ite” and “-ate”. The prefix “hypo-” signifies the oxyanion with the fewest oxygen atoms, while “per-” indicates the one with the most.

Here are some examples of polyionic compounds.

FormulaCationAnionName
NaNO₃SodiumNitrate (NO₃⁻)Sodium nitrate
CaSO₄CalciumSulfate (SO₄²⁻)Calcium sulfate
NH₄ClAmmoniumChloride (Cl⁻)Ammonium chloride
Fe(NO₃)₃Iron(III)Nitrate (NO₃⁻)Iron(III) nitrate
Al(OH)₃AluminumHydroxide (OH⁻)Aluminum hydroxide
KClO4PotassiumPerchlorate (ClO4⁻)Potassium perchlorate

Naming Bases

Bases are substances that release hydroxide ions (OH⁻) in solution. Most bases are ionic compounds made of a cation and the hydroxide ion.

  • To name a base, follow the same rules as naming ionic compounds.
  • Write the name of the cation first, followed by “hydroxide” to represent the OH⁻ ion.

Example: NH4OH

  1. NH4+ is a polyatomic cation that is derived from ammonia (NH3). It is termed ammonium.
  2. OH is a polyatomic anion consisting of oxygen (O) and hydrogen (H), and is a hydroxide.
  3. NH4+ and OH combine to form NH4OH, called ammonium hydroxide, an ionic base.

Other Ionic Compounds

Apart from binary and polyatomic ionic compounds, there is another category of ionic compounds connected to the latter. They are called hydrates. These are compounds that contain water molecules in their crystals. The water content is shown using a dot (·) in the formula. [8]

Rules for Naming Hydrates

  • The number of water molecules is shown after a dot (·) in the formula.
  • We use Greek prefixes to indicate how many water molecules are present. For instance, you could use “mono-” for one atom, “di-” for two, “nona-” for nine, “deca-” for ten, and so on.

Naming Format

Compound name = Greek prefix + hydrate

Examples

FormulaCation (Metal)AnionNumber of hydratesName (common name, if any)
CuSO₄·5H₂OCopper(II)Sulfate5Copper(II) sulfate pentahydrate
BaCl₂·2H₂OBariumChloride2Barium chloride dihydrate
MgSO₄·7H₂OMagnesiumSulfate7Magnesium sulfate heptahydrate (epson salt)
CaSO₄·2H₂OCalciumSulfate2Calcium sulfate dihydrate (gypsum)
Na₂CO₃·10H₂OSodiumCarbonate10Sodium carbonate decahydrate (washing soda)

Learning how to name ionic compounds is an important skill in chemistry. It helps us describe what substances are made of and how their atoms interact. By following a few simple rules, like naming the metal first, using the “-ide” ending for nonmetals, and adding Roman numerals for transition metals, we can correctly name a wide range of compounds.

Leave a Reply

Your email address will not be published. Required fields are marked *